C13H17NO2 — CID 115764896
N-[1-(hydroxymethyl)cyclopropyl]-3,4-dimethylbenzamide (PubChem CID 115764896) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopropyl]-3,4-dimethylbenzamide.
| Compound Name | N-[1-(hydroxymethyl)cyclopropyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 115764896 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopropyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2(CO)CC2)cc1C |
| InChI | InChI=1S/C13H17NO2/c1-9-3-4-11(7-10(9)2)12(16)14-13(8-15)5-6-13/h3-4,7,15H,5-6,8H2,1-2H3,(H,14,16) |
| InChIKey | NGWBDEXLCAEUAJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |