C24H28ClN9 — CID 11576555
N-[(E)-benzylideneamino]-4-[4-(4-chlorophenyl)piperazin-1-yl]-6-piperazin-1-yl-1,3,5-triazin-2-amine (PubChem CID 11576555) has the molecular formula C24H28ClN9 and a molecular weight of 478.00 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-4-[4-(4-chlorophenyl)piperazin-1-yl]-6-piperazin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-benzylideneamino]-4-[4-(4-chlorophenyl)piperazin-1-yl]-6-piperazin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 11576555 |
| Molecular Formula | C24H28ClN9 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[(E)-benzylideneamino]-4-[4-(4-chlorophenyl)piperazin-1-yl]-6-piperazin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1ccc(N2CCN(c3nc(N/N=C/c4ccccc4)nc(N4CCNCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C24H28ClN9/c25-20-6-8-21(9-7-20)32-14-16-34(17-15-32)24-29-22(31-27-18-19-4-2-1-3-5-19)28-23(30-24)33-12-10-26-11-13-33/h1-9,18,26H,10-17H2,(H,28,29,30,31)/b27-18+ |
| InChIKey | AFJVFCHSZHYLIA-OVVQPSECSA-N |
| XLogP | 2.71 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|