C10H14ClNS — CID 115765786
N-[(5-chlorothiophen-2-yl)methyl]-1-methylcyclobutan-1-amine (PubChem CID 115765786) has the molecular formula C10H14ClNS and a molecular weight of 215.75 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1-methylcyclobutan-1-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 115765786 |
| Molecular Formula | C10H14ClNS |
| Molecular Weight | 215.75 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1-methylcyclobutan-1-amine |
| SMILES | CC1(NCc2ccc(Cl)s2)CCC1 |
| InChI | InChI=1S/C10H14ClNS/c1-10(5-2-6-10)12-7-8-3-4-9(11)13-8/h3-4,12H,2,5-7H2,1H3 |
| InChIKey | ROMBXFRRMKSGDZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |