C26H30FN5OS — CID 11576592
[4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(4-fluorophenyl)methanone (PubChem CID 11576592) has the molecular formula C26H30FN5OS and a molecular weight of 479.63 g/mol. Its IUPAC name is [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 11576592 |
| Molecular Formula | C26H30FN5OS |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [4-amino-2-[4-(4-piperidin-1-ylpiperidin-1-yl)anilino]-1,3-thiazol-5-yl]-(4-fluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCCC4)CC3)cc2)sc1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FN5OS/c27-19-6-4-18(5-7-19)23(33)24-25(28)30-26(34-24)29-20-8-10-21(11-9-20)32-16-12-22(13-17-32)31-14-2-1-3-15-31/h4-11,22H,1-3,12-17,28H2,(H,29,30) |
| InChIKey | IOLSYZXBOCNUSA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|