C24H20FN3O5S — CID 11576622
1-[(2-fluoro-4-pyridinyl)methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 11576622) has the molecular formula C24H20FN3O5S and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-[(2-fluoro-4-pyridinyl)methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-[(2-fluoro-4-pyridinyl)methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 11576622 |
| Molecular Formula | C24H20FN3O5S |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1-[(2-fluoro-4-pyridinyl)methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccnc(F)c2)c2ccc(S(=O)(=O)N3CC[C@H]3COc3ccccc3)cc21 |
| InChI | InChI=1S/C24H20FN3O5S/c25-22-12-16(8-10-26-22)14-27-21-7-6-19(13-20(21)23(29)24(27)30)34(31,32)28-11-9-17(28)15-33-18-4-2-1-3-5-18/h1-8,10,12-13,17H,9,11,14-15H2/t17-/m0/s1 |
| InChIKey | RYWKNTKVPRMYNJ-KRWDZBQOSA-N |
| XLogP | 2.79 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|