C9H12F3NO2 — CID 115766531
2,2,2-trifluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 115766531) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 115766531 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1=CCN(C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H12F3NO2/c1-7-2-4-13(5-3-7)8(14)15-6-9(10,11)12/h2H,3-6H2,1H3 |
| InChIKey | XLCSVFGZGGMUEZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|