C15H20N4O — CID 115767897
2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-phenylpropanamide (PubChem CID 115767897) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-phenylpropanamide.
| Compound Name | 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-phenylpropanamide |
|---|---|
| PubChem CID | 115767897 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[(1,3-dimethylpyrazol-4-yl)methylamino]-N-phenylpropanamide |
| SMILES | Cc1nn(C)cc1CNC(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H20N4O/c1-11-13(10-19(3)18-11)9-16-12(2)15(20)17-14-7-5-4-6-8-14/h4-8,10,12,16H,9H2,1-3H3,(H,17,20) |
| InChIKey | PZVMCFUYBOJKPZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |