C24H24F3N3O5 — CID 11576806
ethyl 2-methyl-3-oxo-6-[[1-(3,4,5-trifluorophenyl)piperidine-4-carbonyl]amino]-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 11576806) has the molecular formula C24H24F3N3O5 and a molecular weight of 491.47 g/mol. Its IUPAC name is ethyl 2-methyl-3-oxo-6-[[1-(3,4,5-trifluorophenyl)piperidine-4-carbonyl]amino]-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 2-methyl-3-oxo-6-[[1-(3,4,5-trifluorophenyl)piperidine-4-carbonyl]amino]-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 11576806 |
| Molecular Formula | C24H24F3N3O5 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | ethyl 2-methyl-3-oxo-6-[[1-(3,4,5-trifluorophenyl)piperidine-4-carbonyl]amino]-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)Oc2ccc(NC(=O)C3CCN(c4cc(F)c(F)c(F)c4)CC3)cc2NC1=O |
| InChI | InChI=1S/C24H24F3N3O5/c1-3-34-23(33)24(2)22(32)29-18-10-14(4-5-19(18)35-24)28-21(31)13-6-8-30(9-7-13)15-11-16(25)20(27)17(26)12-15/h4-5,10-13H,3,6-9H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | CYBXWNVHDIVVDR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|