C26H30FN5O2S — CID 11576880
[4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone (PubChem CID 11576880) has the molecular formula C26H30FN5O2S and a molecular weight of 495.62 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 11576880 |
| Molecular Formula | C26H30FN5O2S |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | [4-amino-2-[4-[4-(3-hydroxypiperidin-1-yl)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]-(3-fluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCC(O)C4)CC3)cc2)sc1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H30FN5O2S/c27-18-4-1-3-17(15-18)23(34)24-25(28)30-26(35-24)29-19-6-8-20(9-7-19)31-13-10-21(11-14-31)32-12-2-5-22(33)16-32/h1,3-4,6-9,15,21-22,33H,2,5,10-14,16,28H2,(H,29,30) |
| InChIKey | YUGDECZDYPCPSA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|