C21H32F6N2O5 — CID 11577040
2,4,6-trimethylheptan-4-yl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate (PubChem CID 11577040) has the molecular formula C21H32F6N2O5 and a molecular weight of 506.48 g/mol. Its IUPAC name is 2,4,6-trimethylheptan-4-yl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate.
| Compound Name | 2,4,6-trimethylheptan-4-yl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11577040 |
| Molecular Formula | C21H32F6N2O5 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2,4,6-trimethylheptan-4-yl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
| SMILES | CC(C)CC(C)(CC(C)C)OC(=O)CC(C)NC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C21H32F6N2O5/c1-11(2)9-18(6,10-12(3)4)33-16(30)7-13(5)28-17(31)14-8-15(34-29-14)19(32,20(22,23)24)21(25,26)27/h11-13,15,32H,7-10H2,1-6H3,(H,28,31) |
| InChIKey | KPWQUSYVHGMYLF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |