About 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine
1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 115770403) has the molecular formula C11H11BrF3NO2S2
and a molecular weight of 390.25 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 115770403 |
| Molecular Formula | C11H11BrF3NO2S2 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | Cc1cc(S(=O)(=O)N2CC=C(C(F)(F)F)CC2)sc1Br |
| InChI | InChI=1S/C11H11BrF3NO2S2/c1-7-6-9(19-10(7)12)20(17,18)16-4-2-8(3-5-16)11(13,14)15/h2,6H,3-5H2,1H3 |
| InChIKey | XXQAKUOHSQEKOQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (CID 115770403) is 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine is Cc1cc(S(=O)(=O)N2CC=C(C(F)(F)F)CC2)sc1Br.
What is the InChIKey of 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine?
The InChIKey is XXQAKUOHSQEKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF3NO2S2/c1-7-6-9(19-10(7)12)20(17,18)16-4-2-8(3-5-16)11(13,14)15/h2,6H,3-5H2,1H3.
What are the key properties of 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine?
1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine has a molecular weight of 390.25 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 115770403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).