C27H48O7Si — CID 11577126
prop-2-enyl 2-[(2S,4S,6S,8R,10S)-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4,10-dihydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11577126) has the molecular formula C27H48O7Si and a molecular weight of 512.76 g/mol. Its IUPAC name is prop-2-enyl 2-[(2S,4S,6S,8R,10S)-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4,10-dihydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4,10-dihydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11577126 |
| Molecular Formula | C27H48O7Si |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-2-[(3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-methylidenebutyl]-4,10-dihydroxy-4-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=CCOC(=O)C[C@H]1C[C@H](O)C[C@@]2(C[C@@](C)(O)C[C@H](CC(=C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C27H48O7Si/c1-10-11-31-24(29)14-22-13-21(28)15-27(33-22)18-26(7,30)16-23(34-27)12-19(2)20(3)17-32-35(8,9)25(4,5)6/h10,20-23,28,30H,1-2,11-18H2,3-9H3/t20-,21-,22+,23-,26-,27+/m0/s1 |
| InChIKey | QZJPFYKYPCIWIP-FXMFOZBOSA-N |
| XLogP | 4.88 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|