About 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol
4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 115773224) has the molecular formula C7H13F2NO3S
and a molecular weight of 229.25 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 115773224 |
| Molecular Formula | C7H13F2NO3S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CN(CC(F)F)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C7H13F2NO3S/c1-10(2-7(8)9)5-3-14(12,13)4-6(5)11/h5-7,11H,2-4H2,1H3 |
| InChIKey | KFWJTWKYFXKISJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol (CID 115773224) is 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol is CN(CC(F)F)C1CS(=O)(=O)CC1O.
What is the InChIKey of 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol?
The InChIKey is KFWJTWKYFXKISJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO3S/c1-10(2-7(8)9)5-3-14(12,13)4-6(5)11/h5-7,11H,2-4H2,1H3.
What are the key properties of 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol?
4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol has a molecular weight of 229.25 g/mol, XLogP of -0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoroethyl(methyl)amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 115773224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).