About 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole
1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 115773580) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole.
Molecular Properties
| Compound Name | 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole |
| PubChem CID | 115773580 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | CC#CCn1c(C)nc2c1CCCC2 |
| InChI | InChI=1S/C12H16N2/c1-3-4-9-14-10(2)13-11-7-5-6-8-12(11)14/h5-9H2,1-2H3 |
| InChIKey | JPXXQLUCWNGRRA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole?
The IUPAC name of 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole (CID 115773580) is 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole.
What is the SMILES notation for 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole?
The canonical SMILES for 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole is CC#CCn1c(C)nc2c1CCCC2.
What is the InChIKey of 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole?
The InChIKey is JPXXQLUCWNGRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-3-4-9-14-10(2)13-11-7-5-6-8-12(11)14/h5-9H2,1-2H3.
What are the key properties of 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole?
1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole has a molecular weight of 188.27 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-ynyl-2-methyl-4,5,6,7-tetrahydrobenzimidazole is sourced from PubChem (CID 115773580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).