C15H27N2O+ — CID 11577366
1-methyl-3-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium (PubChem CID 11577366) has the molecular formula C15H27N2O+ and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-methyl-3-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium.
| Compound Name | 1-methyl-3-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 11577366 |
| Molecular Formula | C15H27N2O+ |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 1-methyl-3-[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OCn1cc[n+](C)c1 |
| InChI | InChI=1S/C15H27N2O/c1-12(2)14-6-5-13(3)9-15(14)18-11-17-8-7-16(4)10-17/h7-8,10,12-15H,5-6,9,11H2,1-4H3/q+1/t13-,14+,15-/m0/s1 |
| InChIKey | WXPUXZNAGPBXRP-ZNMIVQPWSA-N |
| XLogP | 2.75 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|