C11H16BrN3O — CID 115773945
2-[(5-bromo-4-methyl-2-pyridinyl)-methylamino]-N-ethylacetamide (PubChem CID 115773945) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is 2-[(5-bromo-4-methyl-2-pyridinyl)-methylamino]-N-ethylacetamide.
| Compound Name | 2-[(5-bromo-4-methyl-2-pyridinyl)-methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 115773945 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-[(5-bromo-4-methyl-2-pyridinyl)-methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)c1cc(C)c(Br)cn1 |
| InChI | InChI=1S/C11H16BrN3O/c1-4-13-11(16)7-15(3)10-5-8(2)9(12)6-14-10/h5-6H,4,7H2,1-3H3,(H,13,16) |
| InChIKey | LHSVOPKABBXNPO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |