C12H17BrN2O — CID 115774207
5-bromo-N,4-dimethyl-N-(oxan-4-yl)pyridin-2-amine (PubChem CID 115774207) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is 5-bromo-N,4-dimethyl-N-(oxan-4-yl)pyridin-2-amine.
| Compound Name | 5-bromo-N,4-dimethyl-N-(oxan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 115774207 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-bromo-N,4-dimethyl-N-(oxan-4-yl)pyridin-2-amine |
| SMILES | Cc1cc(N(C)C2CCOCC2)ncc1Br |
| InChI | InChI=1S/C12H17BrN2O/c1-9-7-12(14-8-11(9)13)15(2)10-3-5-16-6-4-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | KCDXHUITZRKXKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |