C11H17N3O — CID 115774262
[1-[(4,6-dimethylpyrimidin-2-yl)amino]cyclobutyl]methanol (PubChem CID 115774262) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is [1-[(4,6-dimethylpyrimidin-2-yl)amino]cyclobutyl]methanol.
| Compound Name | [1-[(4,6-dimethylpyrimidin-2-yl)amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 115774262 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | [1-[(4,6-dimethylpyrimidin-2-yl)amino]cyclobutyl]methanol |
| SMILES | Cc1cc(C)nc(NC2(CO)CCC2)n1 |
| InChI | InChI=1S/C11H17N3O/c1-8-6-9(2)13-10(12-8)14-11(7-15)4-3-5-11/h6,15H,3-5,7H2,1-2H3,(H,12,13,14) |
| InChIKey | ZUTXNZDIVLPTDU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |