C14H19ClN2 — CID 115774295
2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-chloropyridine (PubChem CID 115774295) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-chloropyridine.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-chloropyridine |
|---|---|
| PubChem CID | 115774295 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-chloropyridine |
| SMILES | CC(C)(C)C1=CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H19ClN2/c1-14(2,3)11-6-8-17(9-7-11)13-5-4-12(15)10-16-13/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | MANRVDIUZRAPDV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|