C10H10FN3O — CID 115774395
2-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-3-one (PubChem CID 115774395) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 115774395 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(Cc2cccc(F)c2)c1=O |
| InChI | InChI=1S/C10H10FN3O/c1-13-7-12-14(10(13)15)6-8-3-2-4-9(11)5-8/h2-5,7H,6H2,1H3 |
| InChIKey | PPMDPIAYWXQCBK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |