About 2-butyl-4-methyl-1,2,4-triazol-3-one
2-butyl-4-methyl-1,2,4-triazol-3-one (PubChem CID 115774482) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-butyl-4-methyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 2-butyl-4-methyl-1,2,4-triazol-3-one |
| PubChem CID | 115774482 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-butyl-4-methyl-1,2,4-triazol-3-one |
| SMILES | CCCCn1ncn(C)c1=O |
| InChI | InChI=1S/C7H13N3O/c1-3-4-5-10-7(11)9(2)6-8-10/h6H,3-5H2,1-2H3 |
| InChIKey | LZHWVAJOEWCWPH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-4-methyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-methyl-1,2,4-triazol-3-one?
The IUPAC name of 2-butyl-4-methyl-1,2,4-triazol-3-one (CID 115774482) is 2-butyl-4-methyl-1,2,4-triazol-3-one.
What is the SMILES notation for 2-butyl-4-methyl-1,2,4-triazol-3-one?
The canonical SMILES for 2-butyl-4-methyl-1,2,4-triazol-3-one is CCCCn1ncn(C)c1=O.
What is the InChIKey of 2-butyl-4-methyl-1,2,4-triazol-3-one?
The InChIKey is LZHWVAJOEWCWPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-3-4-5-10-7(11)9(2)6-8-10/h6H,3-5H2,1-2H3.
What are the key properties of 2-butyl-4-methyl-1,2,4-triazol-3-one?
2-butyl-4-methyl-1,2,4-triazol-3-one has a molecular weight of 155.20 g/mol, XLogP of 0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-methyl-1,2,4-triazol-3-one is sourced from PubChem (CID 115774482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).