C15H19NO — CID 115774534
N-[(2-methyl-1-benzofuran-3-yl)methyl]-1-(2-methylcyclopropyl)methanamine (PubChem CID 115774534) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[(2-methyl-1-benzofuran-3-yl)methyl]-1-(2-methylcyclopropyl)methanamine.
| Compound Name | N-[(2-methyl-1-benzofuran-3-yl)methyl]-1-(2-methylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 115774534 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[(2-methyl-1-benzofuran-3-yl)methyl]-1-(2-methylcyclopropyl)methanamine |
| SMILES | Cc1oc2ccccc2c1CNCC1CC1C |
| InChI | InChI=1S/C15H19NO/c1-10-7-12(10)8-16-9-14-11(2)17-15-6-4-3-5-13(14)15/h3-6,10,12,16H,7-9H2,1-2H3 |
| InChIKey | DSSAIRQZSZVJAW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |