C12H16N2O2S — CID 115775601
(E)-N-(2-hydroxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)-N-prop-2-enylprop-2-enamide (PubChem CID 115775601) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 115775601 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-3-(2-methyl-1,3-thiazol-4-yl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(CCO)C(=O)/C=C/c1csc(C)n1 |
| InChI | InChI=1S/C12H16N2O2S/c1-3-6-14(7-8-15)12(16)5-4-11-9-17-10(2)13-11/h3-5,9,15H,1,6-8H2,2H3/b5-4+ |
| InChIKey | JRPOELHHVATTQQ-SNAWJCMRSA-N |
| XLogP | 1.47 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|