C12H11F4NO2 — CID 115775854
2,3,4,5-tetrafluoro-N-(2-hydroxyethyl)-N-prop-2-enylbenzamide (PubChem CID 115775854) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(2-hydroxyethyl)-N-prop-2-enylbenzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(2-hydroxyethyl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 115775854 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(2-hydroxyethyl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CCO)C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H11F4NO2/c1-2-3-17(4-5-18)12(19)7-6-8(13)10(15)11(16)9(7)14/h2,6,18H,1,3-5H2 |
| InChIKey | ALSUWDGDUJQPFF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|