2-(ethylsulfamoylamino)acetic acid

C4H10N2O4S — CID 115776563

IUPAC2-(ethylsulfamoylamino)acetic acid
SMILESCCNS(=O)(=O)NCC(=O)O
InChIInChI=1S/C4H10N2O4S/c1-2-5-11(9,10)6-3-4(7)8/h5-6H,2-3H2,1H3,(H,7,8)
InChIKeyCRIPFCBHPJAEMA-UHFFFAOYSA-N
MW182.20 g/mol
LogP-1.49
Rot. Bonds5

About 2-(ethylsulfamoylamino)acetic acid

2-(ethylsulfamoylamino)acetic acid (PubChem CID 115776563) has the molecular formula C4H10N2O4S and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-(ethylsulfamoylamino)acetic acid.

Molecular Properties

Compound Name2-(ethylsulfamoylamino)acetic acid
PubChem CID115776563
Molecular FormulaC4H10N2O4S
Molecular Weight182.20 g/mol
Exact Mass182.04
IUPAC Name2-(ethylsulfamoylamino)acetic acid
SMILESCCNS(=O)(=O)NCC(=O)O
InChIInChI=1S/C4H10N2O4S/c1-2-5-11(9,10)6-3-4(7)8/h5-6H,2-3H2,1H3,(H,7,8)
InChIKeyCRIPFCBHPJAEMA-UHFFFAOYSA-N
XLogP-1.49
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.20
LogP ≤ 5-1.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(ethylsulfamoylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(ethylsulfamoylamino)acetic acid?
The IUPAC name of 2-(ethylsulfamoylamino)acetic acid (CID 115776563) is 2-(ethylsulfamoylamino)acetic acid.
What is the SMILES notation for 2-(ethylsulfamoylamino)acetic acid?
The canonical SMILES for 2-(ethylsulfamoylamino)acetic acid is CCNS(=O)(=O)NCC(=O)O.
What is the InChIKey of 2-(ethylsulfamoylamino)acetic acid?
The InChIKey is CRIPFCBHPJAEMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O4S/c1-2-5-11(9,10)6-3-4(7)8/h5-6H,2-3H2,1H3,(H,7,8).
What are the key properties of 2-(ethylsulfamoylamino)acetic acid?
2-(ethylsulfamoylamino)acetic acid has a molecular weight of 182.20 g/mol, XLogP of -1.49, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylsulfamoylamino)acetic acid is sourced from PubChem (CID 115776563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).