C19H20ClIN6O3S — CID 11577804
(2S,3S,4R,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N-ethyl-3,4-dihydroxythiolane-2-carboxamide (PubChem CID 11577804) has the molecular formula C19H20ClIN6O3S and a molecular weight of 574.83 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N-ethyl-3,4-dihydroxythiolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N-ethyl-3,4-dihydroxythiolane-2-carboxamide |
|---|---|
| PubChem CID | 11577804 |
| Molecular Formula | C19H20ClIN6O3S |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.01 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N-ethyl-3,4-dihydroxythiolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1S[C@@H](n2cnc3c(NCc4cccc(I)c4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20ClIN6O3S/c1-2-22-17(30)14-12(28)13(29)18(31-14)27-8-24-11-15(25-19(20)26-16(11)27)23-7-9-4-3-5-10(21)6-9/h3-6,8,12-14,18,28-29H,2,7H2,1H3,(H,22,30)(H,23,25,26)/t12-,13+,14-,18+/m0/s1 |
| InChIKey | YVYTUCAAWMEQEO-MOROJQBDSA-N |
| XLogP | 2.17 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|