C14H10Br2N2OS — CID 115778362
1-(4,5-dibromothiophen-2-yl)-2-(1-methylindazol-3-yl)ethanone (PubChem CID 115778362) has the molecular formula C14H10Br2N2OS and a molecular weight of 414.12 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-(1-methylindazol-3-yl)ethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-(1-methylindazol-3-yl)ethanone |
|---|---|
| PubChem CID | 115778362 |
| Molecular Formula | C14H10Br2N2OS |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 411.89 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-(1-methylindazol-3-yl)ethanone |
| SMILES | Cn1nc(CC(=O)c2cc(Br)c(Br)s2)c2ccccc21 |
| InChI | InChI=1S/C14H10Br2N2OS/c1-18-11-5-3-2-4-8(11)10(17-18)7-12(19)13-6-9(15)14(16)20-13/h2-6H,7H2,1H3 |
| InChIKey | YYISOGJLEGETOI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |