C16H23BrO2 — CID 115779341
1-(5-bromo-2-methoxyphenyl)-4-cyclopentylbutan-2-ol (PubChem CID 115779341) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-4-cyclopentylbutan-2-ol.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-4-cyclopentylbutan-2-ol |
|---|---|
| PubChem CID | 115779341 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-4-cyclopentylbutan-2-ol |
| SMILES | COc1ccc(Br)cc1CC(O)CCC1CCCC1 |
| InChI | InChI=1S/C16H23BrO2/c1-19-16-9-7-14(17)10-13(16)11-15(18)8-6-12-4-2-3-5-12/h7,9-10,12,15,18H,2-6,8,11H2,1H3 |
| InChIKey | LLFCCSDFONGNNF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |