C16H15IN2OS — CID 115782049
1-(5-iodothiophen-3-yl)-2-(1-propylbenzimidazol-2-yl)ethanone (PubChem CID 115782049) has the molecular formula C16H15IN2OS and a molecular weight of 410.28 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-2-(1-propylbenzimidazol-2-yl)ethanone.
| Compound Name | 1-(5-iodothiophen-3-yl)-2-(1-propylbenzimidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 115782049 |
| Molecular Formula | C16H15IN2OS |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-2-(1-propylbenzimidazol-2-yl)ethanone |
| SMILES | CCCn1c(CC(=O)c2csc(I)c2)nc2ccccc21 |
| InChI | InChI=1S/C16H15IN2OS/c1-2-7-19-13-6-4-3-5-12(13)18-16(19)9-14(20)11-8-15(17)21-10-11/h3-6,8,10H,2,7,9H2,1H3 |
| InChIKey | JDHRKMBQTAOVIG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|