C37H37F3N6O3 — CID 11578370
2,4-dimethyl-5-[(Z)-[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]anilino]-1H-indol-3-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide (PubChem CID 11578370) has the molecular formula C37H37F3N6O3 and a molecular weight of 670.74 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(Z)-[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]anilino]-1H-indol-3-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2,4-dimethyl-5-[(Z)-[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]anilino]-1H-indol-3-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11578370 |
| Molecular Formula | C37H37F3N6O3 |
| Molecular Weight | 670.74 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | 2,4-dimethyl-5-[(Z)-[2-oxo-6-[3-[[3-(trifluoromethyl)benzoyl]amino]anilino]-1H-indol-3-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3cc(Nc4cccc(NC(=O)c5cccc(C(F)(F)F)c5)c4)ccc32)c(C)c1C(=O)NCCCN1CCCC1 |
| InChI | InChI=1S/C37H37F3N6O3/c1-22-31(42-23(2)33(22)36(49)41-14-7-17-46-15-3-4-16-46)21-30-29-13-12-28(20-32(29)45-35(30)48)43-26-10-6-11-27(19-26)44-34(47)24-8-5-9-25(18-24)37(38,39)40/h5-6,8-13,18-21,42-43H,3-4,7,14-17H2,1-2H3,(H,41,49)(H,44,47)(H,45,48)/b30-21- |
| InChIKey | FEMBYNBZXPWDNG-OFWBYEQRSA-N |
| XLogP | 7.35 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.74 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|