About 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one
1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one (PubChem CID 115784113) has the molecular formula C13H19BrOS
and a molecular weight of 303.26 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one.
Molecular Properties
| Compound Name | 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one |
| PubChem CID | 115784113 |
| Molecular Formula | C13H19BrOS |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one |
| SMILES | CC(CC(=O)c1cscc1Br)CC(C)(C)C |
| InChI | InChI=1S/C13H19BrOS/c1-9(6-13(2,3)4)5-12(15)10-7-16-8-11(10)14/h7-9H,5-6H2,1-4H3 |
| InChIKey | IOKOVCLQFJRZGM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one?
The IUPAC name of 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one (CID 115784113) is 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one.
What is the SMILES notation for 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one?
The canonical SMILES for 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one is CC(CC(=O)c1cscc1Br)CC(C)(C)C.
What is the InChIKey of 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one?
The InChIKey is IOKOVCLQFJRZGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrOS/c1-9(6-13(2,3)4)5-12(15)10-7-16-8-11(10)14/h7-9H,5-6H2,1-4H3.
What are the key properties of 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one?
1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one has a molecular weight of 303.26 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromothiophen-3-yl)-3,5,5-trimethylhexan-1-one is sourced from PubChem (CID 115784113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).