C14H10BrCl2FO — CID 115784831
2-(5-bromo-2-fluorophenyl)-1-(2,5-dichlorophenyl)ethanol (PubChem CID 115784831) has the molecular formula C14H10BrCl2FO and a molecular weight of 364.04 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-(2,5-dichlorophenyl)ethanol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 115784831 |
| Molecular Formula | C14H10BrCl2FO |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(Cc1cc(Br)ccc1F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H10BrCl2FO/c15-9-1-4-13(18)8(5-9)6-14(19)11-7-10(16)2-3-12(11)17/h1-5,7,14,19H,6H2 |
| InChIKey | XADSNCAANNEHMD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |