C28H22Br4N4O3 — CID 11578637
(2Z)-4,5,6-tribromo-2-[2-bromo-4,4-dimethyl-5-oxo-1-(phenylmethoxymethyl)cyclohepta[d]imidazol-6-ylidene]spiro[1H-indole-3,4'-azetidine]-2'-one (PubChem CID 11578637) has the molecular formula C28H22Br4N4O3 and a molecular weight of 782.12 g/mol. Its IUPAC name is (2Z)-4,5,6-tribromo-2-[2-bromo-4,4-dimethyl-5-oxo-1-(phenylmethoxymethyl)cyclohepta[d]imidazol-6-ylidene]spiro[1H-indole-3,4'-azetidine]-2'-one.
| Compound Name | (2Z)-4,5,6-tribromo-2-[2-bromo-4,4-dimethyl-5-oxo-1-(phenylmethoxymethyl)cyclohepta[d]imidazol-6-ylidene]spiro[1H-indole-3,4'-azetidine]-2'-one |
|---|---|
| PubChem CID | 11578637 |
| Molecular Formula | C28H22Br4N4O3 |
| Molecular Weight | 782.12 g/mol |
| Exact Mass | 777.84 |
| IUPAC Name | (2Z)-4,5,6-tribromo-2-[2-bromo-4,4-dimethyl-5-oxo-1-(phenylmethoxymethyl)cyclohepta[d]imidazol-6-ylidene]spiro[1H-indole-3,4'-azetidine]-2'-one |
| SMILES | CC1(C)C(=O)/C(=C2\Nc3cc(Br)c(Br)c(Br)c3C23CC(=O)N3)C=Cc2c1nc(Br)n2COCc1ccccc1 |
| InChI | InChI=1S/C28H22Br4N4O3/c1-27(2)24-18(36(26(32)34-24)13-39-12-14-6-4-3-5-7-14)9-8-15(25(27)38)23-28(11-19(37)35-28)20-17(33-23)10-16(29)21(30)22(20)31/h3-10,33H,11-13H2,1-2H3,(H,35,37)/b23-15- |
| InChIKey | ACPUVJJBDNJIMT-HAHDFKILSA-N |
| XLogP | 7.08 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.12 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|