C15H14Br2ClN — CID 115786767
1-(4-bromo-2-chlorophenyl)-2-(2-bromophenyl)-N-methylethanamine (PubChem CID 115786767) has the molecular formula C15H14Br2ClN and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-2-(2-bromophenyl)-N-methylethanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-2-(2-bromophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115786767 |
| Molecular Formula | C15H14Br2ClN |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-2-(2-bromophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccccc1Br)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H14Br2ClN/c1-19-15(8-10-4-2-3-5-13(10)17)12-7-6-11(16)9-14(12)18/h2-7,9,15,19H,8H2,1H3 |
| InChIKey | MAMGLZAXRWTPJR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |