C19H30BrN — CID 115787204
2-(2-bromophenyl)-1-(4-butylcyclohexyl)-N-methylethanamine (PubChem CID 115787204) has the molecular formula C19H30BrN and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-(4-butylcyclohexyl)-N-methylethanamine.
| Compound Name | 2-(2-bromophenyl)-1-(4-butylcyclohexyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115787204 |
| Molecular Formula | C19H30BrN |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(2-bromophenyl)-1-(4-butylcyclohexyl)-N-methylethanamine |
| SMILES | CCCCC1CCC(C(Cc2ccccc2Br)NC)CC1 |
| InChI | InChI=1S/C19H30BrN/c1-3-4-7-15-10-12-16(13-11-15)19(21-2)14-17-8-5-6-9-18(17)20/h5-6,8-9,15-16,19,21H,3-4,7,10-14H2,1-2H3 |
| InChIKey | OJZHJJIQKPLTKQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |