C9H18O3S — CID 115787951
2,4-dimethyl-2-methylsulfonylhexan-3-one (PubChem CID 115787951) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,4-dimethyl-2-methylsulfonylhexan-3-one.
| Compound Name | 2,4-dimethyl-2-methylsulfonylhexan-3-one |
|---|---|
| PubChem CID | 115787951 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2,4-dimethyl-2-methylsulfonylhexan-3-one |
| SMILES | CCC(C)C(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H18O3S/c1-6-7(2)8(10)9(3,4)13(5,11)12/h7H,6H2,1-5H3 |
| InChIKey | DOFJATOJHLENLS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |