C15H20O2S2 — CID 115788169
(5-ethylthiophen-2-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanone (PubChem CID 115788169) has the molecular formula C15H20O2S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (5-ethylthiophen-2-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanone.
| Compound Name | (5-ethylthiophen-2-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanone |
|---|---|
| PubChem CID | 115788169 |
| Molecular Formula | C15H20O2S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (5-ethylthiophen-2-yl)-(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanone |
| SMILES | CCc1ccc(C(=O)C2CCOC3(CCSC3)C2)s1 |
| InChI | InChI=1S/C15H20O2S2/c1-2-12-3-4-13(19-12)14(16)11-5-7-17-15(9-11)6-8-18-10-15/h3-4,11H,2,5-10H2,1H3 |
| InChIKey | WZECGTZCYFABCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |