C16H13NOS — CID 115790953
(4,5-dimethylthiophen-2-yl)-quinolin-7-ylmethanone (PubChem CID 115790953) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is (4,5-dimethylthiophen-2-yl)-quinolin-7-ylmethanone.
| Compound Name | (4,5-dimethylthiophen-2-yl)-quinolin-7-ylmethanone |
|---|---|
| PubChem CID | 115790953 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (4,5-dimethylthiophen-2-yl)-quinolin-7-ylmethanone |
| SMILES | Cc1cc(C(=O)c2ccc3cccnc3c2)sc1C |
| InChI | InChI=1S/C16H13NOS/c1-10-8-15(19-11(10)2)16(18)13-6-5-12-4-3-7-17-14(12)9-13/h3-9H,1-2H3 |
| InChIKey | DDEUMQALQXLTHS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |