C28H54N4O2 — CID 11579097
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanediamide (PubChem CID 11579097) has the molecular formula C28H54N4O2 and a molecular weight of 478.77 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanediamide.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanediamide |
|---|---|
| PubChem CID | 11579097 |
| Molecular Formula | C28H54N4O2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.42 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)decanediamide |
| SMILES | CC1(C)CC(NC(=O)CCCCCCCCC(=O)NC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C28H54N4O2/c1-25(2)17-21(18-26(3,4)31-25)29-23(33)15-13-11-9-10-12-14-16-24(34)30-22-19-27(5,6)32-28(7,8)20-22/h21-22,31-32H,9-20H2,1-8H3,(H,29,33)(H,30,34) |
| InChIKey | VAHCNPFPFXAVCE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|