C13H3ClF6O — CID 115791516
(4-chloro-2-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 115791516) has the molecular formula C13H3ClF6O and a molecular weight of 324.61 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | (4-chloro-2-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 115791516 |
| Molecular Formula | C13H3ClF6O |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H3ClF6O/c14-4-1-2-5(6(15)3-4)13(21)7-8(16)10(18)12(20)11(19)9(7)17/h1-3H |
| InChIKey | PABKEKPZRNQQBY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|