C7H15NO4 — CID 11579214
(1R,2S,3R,5R)-4-amino-3,5-dimethoxycyclopentane-1,2-diol (PubChem CID 11579214) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (1R,2S,3R,5R)-4-amino-3,5-dimethoxycyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-4-amino-3,5-dimethoxycyclopentane-1,2-diol |
|---|---|
| PubChem CID | 11579214 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (1R,2S,3R,5R)-4-amino-3,5-dimethoxycyclopentane-1,2-diol |
| SMILES | CO[C@@H]1C(N)[C@@H](OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15NO4/c1-11-6-3(8)7(12-2)5(10)4(6)9/h3-7,9-10H,8H2,1-2H3/t3?,4-,5+,6-,7-/m1/s1 |
| InChIKey | LFIWDMUYTNOWMJ-BOYHRMMASA-N |
| XLogP | -1.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |