About N-[(2E,6Z)-nona-2,6-dienyl]acetamide
N-[(2E,6Z)-nona-2,6-dienyl]acetamide (PubChem CID 11579226) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(2E,6Z)-nona-2,6-dienyl]acetamide.
Molecular Properties
| Compound Name | N-[(2E,6Z)-nona-2,6-dienyl]acetamide |
| PubChem CID | 11579226 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(2E,6Z)-nona-2,6-dienyl]acetamide |
| SMILES | CC/C=C\CC/C=C/CNC(C)=O |
| InChI | InChI=1S/C11H19NO/c1-3-4-5-6-7-8-9-10-12-11(2)13/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,12,13)/b5-4-,9-8+ |
| InChIKey | ZSTOSGAUSBVZCU-FTGFODROSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,6Z)-nona-2,6-dienyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,6Z)-nona-2,6-dienyl]acetamide?
The IUPAC name of N-[(2E,6Z)-nona-2,6-dienyl]acetamide (CID 11579226) is N-[(2E,6Z)-nona-2,6-dienyl]acetamide.
What is the SMILES notation for N-[(2E,6Z)-nona-2,6-dienyl]acetamide?
The canonical SMILES for N-[(2E,6Z)-nona-2,6-dienyl]acetamide is CC/C=C\CC/C=C/CNC(C)=O.
What is the InChIKey of N-[(2E,6Z)-nona-2,6-dienyl]acetamide?
The InChIKey is ZSTOSGAUSBVZCU-FTGFODROSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-4-5-6-7-8-9-10-12-11(2)13/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,12,13)/b5-4-,9-8+.
What are the key properties of N-[(2E,6Z)-nona-2,6-dienyl]acetamide?
N-[(2E,6Z)-nona-2,6-dienyl]acetamide has a molecular weight of 181.28 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,6Z)-nona-2,6-dienyl]acetamide is sourced from PubChem (CID 11579226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).