C17H17ClO — CID 115792581
1-(2-chloro-3-methylphenyl)-2-(2,6-dimethylphenyl)ethanone (PubChem CID 115792581) has the molecular formula C17H17ClO and a molecular weight of 272.78 g/mol. Its IUPAC name is 1-(2-chloro-3-methylphenyl)-2-(2,6-dimethylphenyl)ethanone.
| Compound Name | 1-(2-chloro-3-methylphenyl)-2-(2,6-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 115792581 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(2-chloro-3-methylphenyl)-2-(2,6-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cc2c(C)cccc2C)c1Cl |
| InChI | InChI=1S/C17H17ClO/c1-11-6-4-7-12(2)15(11)10-16(19)14-9-5-8-13(3)17(14)18/h4-9H,10H2,1-3H3 |
| InChIKey | TUBNNYNYZJXTNX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |