C14H21NO2 — CID 115793471
1-(5-methoxy-3-pyridinyl)-3,4,4-trimethylpentan-1-one (PubChem CID 115793471) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(5-methoxy-3-pyridinyl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(5-methoxy-3-pyridinyl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 115793471 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-(5-methoxy-3-pyridinyl)-3,4,4-trimethylpentan-1-one |
| SMILES | COc1cncc(C(=O)CC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H21NO2/c1-10(14(2,3)4)6-13(16)11-7-12(17-5)9-15-8-11/h7-10H,6H2,1-5H3 |
| InChIKey | OEVAOPPEYKVJML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |