C18H22BrN — CID 115793778
1-(4-bromo-3-methylphenyl)-N-ethyl-3-phenylpropan-1-amine (PubChem CID 115793778) has the molecular formula C18H22BrN and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-N-ethyl-3-phenylpropan-1-amine.
| Compound Name | 1-(4-bromo-3-methylphenyl)-N-ethyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 115793778 |
| Molecular Formula | C18H22BrN |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-N-ethyl-3-phenylpropan-1-amine |
| SMILES | CCNC(CCc1ccccc1)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C18H22BrN/c1-3-20-18(12-9-15-7-5-4-6-8-15)16-10-11-17(19)14(2)13-16/h4-8,10-11,13,18,20H,3,9,12H2,1-2H3 |
| InChIKey | YMCJNWMUWWHQQS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |