About N-hexyl-3,5-dimethylpyrazole-1-carboxamide
N-hexyl-3,5-dimethylpyrazole-1-carboxamide (PubChem CID 11579460) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is N-hexyl-3,5-dimethylpyrazole-1-carboxamide.
Molecular Properties
| Compound Name | N-hexyl-3,5-dimethylpyrazole-1-carboxamide |
| PubChem CID | 11579460 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-hexyl-3,5-dimethylpyrazole-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1nc(C)cc1C |
| InChI | InChI=1S/C12H21N3O/c1-4-5-6-7-8-13-12(16)15-11(3)9-10(2)14-15/h9H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | CFTOWPIUYFEZNI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-3,5-dimethylpyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-3,5-dimethylpyrazole-1-carboxamide?
The IUPAC name of N-hexyl-3,5-dimethylpyrazole-1-carboxamide (CID 11579460) is N-hexyl-3,5-dimethylpyrazole-1-carboxamide.
What is the SMILES notation for N-hexyl-3,5-dimethylpyrazole-1-carboxamide?
The canonical SMILES for N-hexyl-3,5-dimethylpyrazole-1-carboxamide is CCCCCCNC(=O)n1nc(C)cc1C.
What is the InChIKey of N-hexyl-3,5-dimethylpyrazole-1-carboxamide?
The InChIKey is CFTOWPIUYFEZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c1-4-5-6-7-8-13-12(16)15-11(3)9-10(2)14-15/h9H,4-8H2,1-3H3,(H,13,16).
What are the key properties of N-hexyl-3,5-dimethylpyrazole-1-carboxamide?
N-hexyl-3,5-dimethylpyrazole-1-carboxamide has a molecular weight of 223.32 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-3,5-dimethylpyrazole-1-carboxamide is sourced from PubChem (CID 11579460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).