About cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone
cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone (PubChem CID 115794767) has the molecular formula C14H16OS2
and a molecular weight of 264.41 g/mol. Its IUPAC name is cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone.
Molecular Properties
| Compound Name | cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone |
| PubChem CID | 115794767 |
| Molecular Formula | C14H16OS2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone |
| SMILES | O=C(c1cc2sccc2s1)C1CCCCCC1 |
| InChI | InChI=1S/C14H16OS2/c15-14(10-5-3-1-2-4-6-10)13-9-12-11(17-13)7-8-16-12/h7-10H,1-6H2 |
| InChIKey | IXWITNIMTZVQPT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone?
The IUPAC name of cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone (CID 115794767) is cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone.
What is the SMILES notation for cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone?
The canonical SMILES for cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone is O=C(c1cc2sccc2s1)C1CCCCCC1.
What is the InChIKey of cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone?
The InChIKey is IXWITNIMTZVQPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16OS2/c15-14(10-5-3-1-2-4-6-10)13-9-12-11(17-13)7-8-16-12/h7-10H,1-6H2.
What are the key properties of cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone?
cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone has a molecular weight of 264.41 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl(thieno[3,2-b]thiophen-5-yl)methanone is sourced from PubChem (CID 115794767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).