C11H14O4S — CID 115795938
1-(1,1-dioxothian-2-yl)-2-(furan-3-yl)ethanone (PubChem CID 115795938) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-2-(furan-3-yl)ethanone.
| Compound Name | 1-(1,1-dioxothian-2-yl)-2-(furan-3-yl)ethanone |
|---|---|
| PubChem CID | 115795938 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-2-(furan-3-yl)ethanone |
| SMILES | O=C(Cc1ccoc1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H14O4S/c12-10(7-9-4-5-15-8-9)11-3-1-2-6-16(11,13)14/h4-5,8,11H,1-3,6-7H2 |
| InChIKey | FCKHRYQLZMJGRR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |