About 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine
2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine (PubChem CID 11579618) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| PubChem CID | 11579618 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCOCc1nc2c([nH]1)c(N)nc1ccccc12 |
| InChI | InChI=1S/C13H14N4O/c1-2-18-7-10-16-11-8-5-3-4-6-9(8)15-13(14)12(11)17-10/h3-6H,2,7H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | DEVCLHVFELRPIU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
The IUPAC name of 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine (CID 11579618) is 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
The canonical SMILES for 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine is CCOCc1nc2c([nH]1)c(N)nc1ccccc12.
What is the InChIKey of 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
The InChIKey is DEVCLHVFELRPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c1-2-18-7-10-16-11-8-5-3-4-6-9(8)15-13(14)12(11)17-10/h3-6H,2,7H2,1H3,(H2,14,15)(H,16,17).
What are the key properties of 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine?
2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine has a molecular weight of 242.28 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 11579618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).