C11H14BrFO — CID 115796476
1-(2-bromo-3-fluorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 115796476) has the molecular formula C11H14BrFO and a molecular weight of 261.13 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115796476 |
| Molecular Formula | C11H14BrFO |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cccc(F)c1Br |
| InChI | InChI=1S/C11H14BrFO/c1-11(2,3)10(14)7-5-4-6-8(13)9(7)12/h4-6,10,14H,1-3H3 |
| InChIKey | HMCMLNOIVUXCIN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |